C11H16F2N2 — CID 116933552
1-(2,5-difluorophenyl)-3-methylbutane-1,3-diamine (PubChem CID 116933552) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-methylbutane-1,3-diamine.
| Compound Name | 1-(2,5-difluorophenyl)-3-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 116933552 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-methylbutane-1,3-diamine |
| SMILES | CC(C)(N)CC(N)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H16F2N2/c1-11(2,15)6-10(14)8-5-7(12)3-4-9(8)13/h3-5,10H,6,14-15H2,1-2H3 |
| InChIKey | MWUSUASCVXOPKV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |