C10H23N3 — CID 116933806
1-(1-methylpiperidin-3-yl)butane-1,4-diamine (PubChem CID 116933806) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-(1-methylpiperidin-3-yl)butane-1,4-diamine.
| Compound Name | 1-(1-methylpiperidin-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116933806 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1-(1-methylpiperidin-3-yl)butane-1,4-diamine |
| SMILES | CN1CCCC(C(N)CCCN)C1 |
| InChI | InChI=1S/C10H23N3/c1-13-7-3-4-9(8-13)10(12)5-2-6-11/h9-10H,2-8,11-12H2,1H3 |
| InChIKey | JWFGQCBCHPLEFA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |