C11H16BrFN2 — CID 116933922
1-(5-bromo-2-fluorophenyl)-N'-methylbutane-1,4-diamine (PubChem CID 116933922) has the molecular formula C11H16BrFN2 and a molecular weight of 275.17 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-N'-methylbutane-1,4-diamine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116933922 |
| Molecular Formula | C11H16BrFN2 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-N'-methylbutane-1,4-diamine |
| SMILES | CNCCCC(N)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H16BrFN2/c1-15-6-2-3-11(14)9-7-8(12)4-5-10(9)13/h4-5,7,11,15H,2-3,6,14H2,1H3 |
| InChIKey | CYLUHZMJDGRDLR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|