C11H16ClFN2 — CID 116934210
1-(5-chloro-2-fluorophenyl)-3-methylbutane-1,4-diamine (PubChem CID 116934210) has the molecular formula C11H16ClFN2 and a molecular weight of 230.71 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-3-methylbutane-1,4-diamine.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-3-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116934210 |
| Molecular Formula | C11H16ClFN2 |
| Molecular Weight | 230.71 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-3-methylbutane-1,4-diamine |
| SMILES | CC(CN)CC(N)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H16ClFN2/c1-7(6-14)4-11(15)9-5-8(12)2-3-10(9)13/h2-3,5,7,11H,4,6,14-15H2,1H3 |
| InChIKey | VSSWWGWTPXFACW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |