C13H18N2O — CID 116934253
1-(1-benzofuran-3-yl)-3-methylbutane-1,4-diamine (PubChem CID 116934253) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(1-benzofuran-3-yl)-3-methylbutane-1,4-diamine.
| Compound Name | 1-(1-benzofuran-3-yl)-3-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116934253 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(1-benzofuran-3-yl)-3-methylbutane-1,4-diamine |
| SMILES | CC(CN)CC(N)c1coc2ccccc12 |
| InChI | InChI=1S/C13H18N2O/c1-9(7-14)6-12(15)11-8-16-13-5-3-2-4-10(11)13/h2-5,8-9,12H,6-7,14-15H2,1H3 |
| InChIKey | HISFSWKBWACDLM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |