C12H19BrN2 — CID 116934538
1-(3-bromophenyl)-2,2-dimethylbutane-1,4-diamine (PubChem CID 116934538) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,2-dimethylbutane-1,4-diamine.
| Compound Name | 1-(3-bromophenyl)-2,2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116934538 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(3-bromophenyl)-2,2-dimethylbutane-1,4-diamine |
| SMILES | CC(C)(CCN)C(N)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H19BrN2/c1-12(2,6-7-14)11(15)9-4-3-5-10(13)8-9/h3-5,8,11H,6-7,14-15H2,1-2H3 |
| InChIKey | LUMLOWZMJHEPMG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |