C14H20N4 — CID 116937177
4-[amino(3H-benzimidazol-5-yl)methyl]cyclohexan-1-amine (PubChem CID 116937177) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-[amino(3H-benzimidazol-5-yl)methyl]cyclohexan-1-amine.
| Compound Name | 4-[amino(3H-benzimidazol-5-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 116937177 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-[amino(3H-benzimidazol-5-yl)methyl]cyclohexan-1-amine |
| SMILES | NC1CCC(C(N)c2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C14H20N4/c15-11-4-1-9(2-5-11)14(16)10-3-6-12-13(7-10)18-8-17-12/h3,6-9,11,14H,1-2,4-5,15-16H2,(H,17,18) |
| InChIKey | AXYHBWVQLNHTAM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |