C12H15ClN2O — CID 116937542
6-(1-amino-2-chloroethyl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 116937542) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 6-(1-amino-2-chloroethyl)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(1-amino-2-chloroethyl)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 116937542 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-(1-amino-2-chloroethyl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(C(N)CCl)ccc21 |
| InChI | InChI=1S/C12H15ClN2O/c1-15-11-4-2-8(10(14)7-13)6-9(11)3-5-12(15)16/h2,4,6,10H,3,5,7,14H2,1H3 |
| InChIKey | FQRZJAPWXBJZHX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|