About 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine
1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine (PubChem CID 116939268) has the molecular formula C9H13FN2
and a molecular weight of 168.21 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine |
| PubChem CID | 116939268 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine |
| SMILES | CNC(N)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C9H13FN2/c1-6-5-7(9(11)12-2)3-4-8(6)10/h3-5,9,12H,11H2,1-2H3 |
| InChIKey | GHZVRBGTBHNECC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine?
The IUPAC name of 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine (CID 116939268) is 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine.
What is the SMILES notation for 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine?
The canonical SMILES for 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine is CNC(N)c1ccc(F)c(C)c1.
What is the InChIKey of 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine?
The InChIKey is GHZVRBGTBHNECC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2/c1-6-5-7(9(11)12-2)3-4-8(6)10/h3-5,9,12H,11H2,1-2H3.
What are the key properties of 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine?
1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine has a molecular weight of 168.21 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-3-methylphenyl)-N'-methylmethanediamine is sourced from PubChem (CID 116939268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).