About 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine
1-(4-butan-2-ylphenyl)-N'-methylmethanediamine (PubChem CID 116939281) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine |
| PubChem CID | 116939281 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine |
| SMILES | CCC(C)c1ccc(C(N)NC)cc1 |
| InChI | InChI=1S/C12H20N2/c1-4-9(2)10-5-7-11(8-6-10)12(13)14-3/h5-9,12,14H,4,13H2,1-3H3 |
| InChIKey | PXPQGUYJJBXKSR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine?
The IUPAC name of 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine (CID 116939281) is 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine.
What is the SMILES notation for 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine?
The canonical SMILES for 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine is CCC(C)c1ccc(C(N)NC)cc1.
What is the InChIKey of 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine?
The InChIKey is PXPQGUYJJBXKSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-4-9(2)10-5-7-11(8-6-10)12(13)14-3/h5-9,12,14H,4,13H2,1-3H3.
What are the key properties of 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine?
1-(4-butan-2-ylphenyl)-N'-methylmethanediamine has a molecular weight of 192.31 g/mol, XLogP of 2.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butan-2-ylphenyl)-N'-methylmethanediamine is sourced from PubChem (CID 116939281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).