About amino-(1,2-dimethylbenzimidazol-5-yl)methanol
amino-(1,2-dimethylbenzimidazol-5-yl)methanol (PubChem CID 116939675) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is amino-(1,2-dimethylbenzimidazol-5-yl)methanol.
Molecular Properties
| Compound Name | amino-(1,2-dimethylbenzimidazol-5-yl)methanol |
| PubChem CID | 116939675 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | amino-(1,2-dimethylbenzimidazol-5-yl)methanol |
| SMILES | Cc1nc2cc(C(N)O)ccc2n1C |
| InChI | InChI=1S/C10H13N3O/c1-6-12-8-5-7(10(11)14)3-4-9(8)13(6)2/h3-5,10,14H,11H2,1-2H3 |
| InChIKey | DCLDLCUBPHKVGW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze amino-(1,2-dimethylbenzimidazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-(1,2-dimethylbenzimidazol-5-yl)methanol?
The IUPAC name of amino-(1,2-dimethylbenzimidazol-5-yl)methanol (CID 116939675) is amino-(1,2-dimethylbenzimidazol-5-yl)methanol.
What is the SMILES notation for amino-(1,2-dimethylbenzimidazol-5-yl)methanol?
The canonical SMILES for amino-(1,2-dimethylbenzimidazol-5-yl)methanol is Cc1nc2cc(C(N)O)ccc2n1C.
What is the InChIKey of amino-(1,2-dimethylbenzimidazol-5-yl)methanol?
The InChIKey is DCLDLCUBPHKVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-6-12-8-5-7(10(11)14)3-4-9(8)13(6)2/h3-5,10,14H,11H2,1-2H3.
What are the key properties of amino-(1,2-dimethylbenzimidazol-5-yl)methanol?
amino-(1,2-dimethylbenzimidazol-5-yl)methanol has a molecular weight of 191.23 g/mol, XLogP of 0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino-(1,2-dimethylbenzimidazol-5-yl)methanol is sourced from PubChem (CID 116939675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).