C14H23N3S — CID 116939916
1-(4-methylsulfanylphenyl)-3-piperazin-1-ylpropan-1-amine (PubChem CID 116939916) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-3-piperazin-1-ylpropan-1-amine.
| Compound Name | 1-(4-methylsulfanylphenyl)-3-piperazin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 116939916 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-3-piperazin-1-ylpropan-1-amine |
| SMILES | CSc1ccc(C(N)CCN2CCNCC2)cc1 |
| InChI | InChI=1S/C14H23N3S/c1-18-13-4-2-12(3-5-13)14(15)6-9-17-10-7-16-8-11-17/h2-5,14,16H,6-11,15H2,1H3 |
| InChIKey | DCYBYKXHOHWOBF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |