C11H14FNO2 — CID 116940506
4-amino-4-(5-fluoro-2-methoxyphenyl)butan-2-one (PubChem CID 116940506) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 4-amino-4-(5-fluoro-2-methoxyphenyl)butan-2-one.
| Compound Name | 4-amino-4-(5-fluoro-2-methoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 116940506 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-amino-4-(5-fluoro-2-methoxyphenyl)butan-2-one |
| SMILES | COc1ccc(F)cc1C(N)CC(C)=O |
| InChI | InChI=1S/C11H14FNO2/c1-7(14)5-10(13)9-6-8(12)3-4-11(9)15-2/h3-4,6,10H,5,13H2,1-2H3 |
| InChIKey | YRWQXTFSEKKFEA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |