C14H23N3O2 — CID 116941249
(2,5-dimethoxyphenyl)-(1-methylpiperazin-2-yl)methanamine (PubChem CID 116941249) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(1-methylpiperazin-2-yl)methanamine.
| Compound Name | (2,5-dimethoxyphenyl)-(1-methylpiperazin-2-yl)methanamine |
|---|---|
| PubChem CID | 116941249 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(1-methylpiperazin-2-yl)methanamine |
| SMILES | COc1ccc(OC)c(C(N)C2CNCCN2C)c1 |
| InChI | InChI=1S/C14H23N3O2/c1-17-7-6-16-9-12(17)14(15)11-8-10(18-2)4-5-13(11)19-3/h4-5,8,12,14,16H,6-7,9,15H2,1-3H3 |
| InChIKey | OGXKZRYQAIPJSA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |