C14H22N2O3 — CID 116941470
1-(2,5-dimethoxyphenyl)-2-morpholin-3-ylethanamine (PubChem CID 116941470) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-morpholin-3-ylethanamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-morpholin-3-ylethanamine |
|---|---|
| PubChem CID | 116941470 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-morpholin-3-ylethanamine |
| SMILES | COc1ccc(OC)c(C(N)CC2COCCN2)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-17-11-3-4-14(18-2)12(8-11)13(15)7-10-9-19-6-5-16-10/h3-4,8,10,13,16H,5-7,9,15H2,1-2H3 |
| InChIKey | RSSNLCQUSIOYJV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |