C11H18O4 — CID 11694204
methyl 2-[(3aS,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]acetate (PubChem CID 11694204) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl 2-[(3aS,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]acetate.
| Compound Name | methyl 2-[(3aS,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]acetate |
|---|---|
| PubChem CID | 11694204 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | methyl 2-[(3aS,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]acetate |
| SMILES | COC(=O)C[C@@]12CCC[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C11H18O4/c1-10(2)14-8-5-4-6-11(8,15-10)7-9(12)13-3/h8H,4-7H2,1-3H3/t8-,11-/m0/s1 |
| InChIKey | XVMSXNGLDPHQHU-KWQFWETISA-N |
| XLogP | 1.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |