About trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one
trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one (PubChem CID 11694263) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one |
| PubChem CID | 11694263 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one |
| SMILES | CC(C)=CCC(C)(C)[C@@H]1CC[C@@H](C)CC1=O |
| InChI | InChI=1S/C15H26O/c1-11(2)8-9-15(4,5)13-7-6-12(3)10-14(13)16/h8,12-13H,6-7,9-10H2,1-5H3/t12-,13-/m1/s1 |
| InChIKey | RTSGYWDRHAMSGW-CHWSQXEVSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one?
The IUPAC name of trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one (CID 11694263) is trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one.
What is the SMILES notation for trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one?
The canonical SMILES for trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one is CC(C)=CCC(C)(C)[C@@H]1CC[C@@H](C)CC1=O.
What is the InChIKey of trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one?
The InChIKey is RTSGYWDRHAMSGW-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H26O/c1-11(2)8-9-15(4,5)13-7-6-12(3)10-14(13)16/h8,12-13H,6-7,9-10H2,1-5H3/t12-,13-/m1/s1.
What are the key properties of trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one?
trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one has a molecular weight of 222.37 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,5R)-2-(2,5-dimethylhex-4-en-2-yl)-5-methylcyclohexan-1-one is sourced from PubChem (CID 11694263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).