About N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide
N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide (PubChem CID 11694338) has the molecular formula C10H22N2O2S
and a molecular weight of 234.36 g/mol. Its IUPAC name is N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide |
| PubChem CID | 11694338 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC[C@H]1CC[C@@H](N)C1 |
| InChI | InChI=1S/C10H22N2O2S/c1-2-3-6-15(13,14)12-8-9-4-5-10(11)7-9/h9-10,12H,2-8,11H2,1H3/t9-,10+/m0/s1 |
| InChIKey | DKBMUILSFHLRMS-VHSXEESVSA-N |
| XLogP | 0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide?
The IUPAC name of N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide (CID 11694338) is N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide.
What is the SMILES notation for N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide?
The canonical SMILES for N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide is CCCCS(=O)(=O)NC[C@H]1CC[C@@H](N)C1.
What is the InChIKey of N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide?
The InChIKey is DKBMUILSFHLRMS-VHSXEESVSA-N. The full InChI is InChI=1S/C10H22N2O2S/c1-2-3-6-15(13,14)12-8-9-4-5-10(11)7-9/h9-10,12H,2-8,11H2,1H3/t9-,10+/m0/s1.
What are the key properties of N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide?
N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide has a molecular weight of 234.36 g/mol, XLogP of 0.83, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1S,3R)-3-aminocyclopentyl]methyl]butane-1-sulfonamide is sourced from PubChem (CID 11694338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).