C12H12ClFN2 — CID 116943715
1-[amino-(3-chloro-4-fluorophenyl)methyl]cyclobutane-1-carbonitrile (PubChem CID 116943715) has the molecular formula C12H12ClFN2 and a molecular weight of 238.69 g/mol. Its IUPAC name is 1-[amino-(3-chloro-4-fluorophenyl)methyl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[amino-(3-chloro-4-fluorophenyl)methyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 116943715 |
| Molecular Formula | C12H12ClFN2 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-[amino-(3-chloro-4-fluorophenyl)methyl]cyclobutane-1-carbonitrile |
| SMILES | N#CC1(C(N)c2ccc(F)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C12H12ClFN2/c13-9-6-8(2-3-10(9)14)11(16)12(7-15)4-1-5-12/h2-3,6,11H,1,4-5,16H2 |
| InChIKey | UAXDHJMBFXAZDK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |