C12H16FNO2 — CID 116944770
[3-[amino-(4-fluoro-3-methylphenyl)methyl]oxetan-3-yl]methanol (PubChem CID 116944770) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is [3-[amino-(4-fluoro-3-methylphenyl)methyl]oxetan-3-yl]methanol.
| Compound Name | [3-[amino-(4-fluoro-3-methylphenyl)methyl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 116944770 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [3-[amino-(4-fluoro-3-methylphenyl)methyl]oxetan-3-yl]methanol |
| SMILES | Cc1cc(C(N)C2(CO)COC2)ccc1F |
| InChI | InChI=1S/C12H16FNO2/c1-8-4-9(2-3-10(8)13)11(14)12(5-15)6-16-7-12/h2-4,11,15H,5-7,14H2,1H3 |
| InChIKey | JRROIDQUUCKWRT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |