C12H17NO3S — CID 11694528
6-(benzenesulfinyl)-N-hydroxyhexanamide (PubChem CID 11694528) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 6-(benzenesulfinyl)-N-hydroxyhexanamide.
| Compound Name | 6-(benzenesulfinyl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 11694528 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 6-(benzenesulfinyl)-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCS(=O)c1ccccc1)NO |
| InChI | InChI=1S/C12H17NO3S/c14-12(13-15)9-5-2-6-10-17(16)11-7-3-1-4-8-11/h1,3-4,7-8,15H,2,5-6,9-10H2,(H,13,14) |
| InChIKey | LIZWRHXVIWNMIS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|