C9H17F2NO3S — CID 11694544
3-amino-3-cyclohexyl-2,2-difluoropropane-1-sulfonic acid (PubChem CID 11694544) has the molecular formula C9H17F2NO3S and a molecular weight of 257.30 g/mol. Its IUPAC name is 3-amino-3-cyclohexyl-2,2-difluoropropane-1-sulfonic acid.
| Compound Name | 3-amino-3-cyclohexyl-2,2-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 11694544 |
| Molecular Formula | C9H17F2NO3S |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-amino-3-cyclohexyl-2,2-difluoropropane-1-sulfonic acid |
| SMILES | NC(C1CCCCC1)C(F)(F)CS(=O)(=O)O |
| InChI | InChI=1S/C9H17F2NO3S/c10-9(11,6-16(13,14)15)8(12)7-4-2-1-3-5-7/h7-8H,1-6,12H2,(H,13,14,15) |
| InChIKey | UNXDKTCGSVDRJO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|