C12H27N3 — CID 116946567
2,2,4-trimethyl-1-piperazin-1-ylpentan-3-amine (PubChem CID 116946567) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 2,2,4-trimethyl-1-piperazin-1-ylpentan-3-amine.
| Compound Name | 2,2,4-trimethyl-1-piperazin-1-ylpentan-3-amine |
|---|---|
| PubChem CID | 116946567 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 2,2,4-trimethyl-1-piperazin-1-ylpentan-3-amine |
| SMILES | CC(C)C(N)C(C)(C)CN1CCNCC1 |
| InChI | InChI=1S/C12H27N3/c1-10(2)11(13)12(3,4)9-15-7-5-14-6-8-15/h10-11,14H,5-9,13H2,1-4H3 |
| InChIKey | IQLJSLUUDRVNQL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |