About 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone
2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone (PubChem CID 11694682) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone.
Molecular Properties
| Compound Name | 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone |
| PubChem CID | 11694682 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone |
| SMILES | O=C(C[C@H]1OCCC[C@@H]1O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18O3/c18-15-6-3-9-20-17(15)11-16(19)14-8-7-12-4-1-2-5-13(12)10-14/h1-2,4-5,7-8,10,15,17-18H,3,6,9,11H2/t15-,17+/m0/s1 |
| InChIKey | DFSKHKKZUGVJJG-DOTOQJQBSA-N |
| XLogP | 2.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone?
The IUPAC name of 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone (CID 11694682) is 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone.
What is the SMILES notation for 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone?
The canonical SMILES for 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone is O=C(C[C@H]1OCCC[C@@H]1O)c1ccc2ccccc2c1.
What is the InChIKey of 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone?
The InChIKey is DFSKHKKZUGVJJG-DOTOQJQBSA-N. The full InChI is InChI=1S/C17H18O3/c18-15-6-3-9-20-17(15)11-16(19)14-8-7-12-4-1-2-5-13(12)10-14/h1-2,4-5,7-8,10,15,17-18H,3,6,9,11H2/t15-,17+/m0/s1.
What are the key properties of 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone?
2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone has a molecular weight of 270.33 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3S)-3-hydroxyoxan-2-yl]-1-naphthalen-2-ylethanone is sourced from PubChem (CID 11694682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).