C13H28N4 — CID 116946834
2-methyl-1-(1-methylpyrrolidin-3-yl)-2-piperazin-1-ylpropan-1-amine (PubChem CID 116946834) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-methyl-1-(1-methylpyrrolidin-3-yl)-2-piperazin-1-ylpropan-1-amine.
| Compound Name | 2-methyl-1-(1-methylpyrrolidin-3-yl)-2-piperazin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 116946834 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | 2-methyl-1-(1-methylpyrrolidin-3-yl)-2-piperazin-1-ylpropan-1-amine |
| SMILES | CN1CCC(C(N)C(C)(C)N2CCNCC2)C1 |
| InChI | InChI=1S/C13H28N4/c1-13(2,17-8-5-15-6-9-17)12(14)11-4-7-16(3)10-11/h11-12,15H,4-10,14H2,1-3H3 |
| InChIKey | DOVBFQLPKVYINA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |