About 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole
2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole (PubChem CID 11694720) has the molecular formula C14H8FNO2S
and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole |
| PubChem CID | 11694720 |
| Molecular Formula | C14H8FNO2S |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole |
| SMILES | Fc1ccc2sc(-c3ccc4c(c3)OCO4)nc2c1 |
| InChI | InChI=1S/C14H8FNO2S/c15-9-2-4-13-10(6-9)16-14(19-13)8-1-3-11-12(5-8)18-7-17-11/h1-6H,7H2 |
| InChIKey | AANCATSPMWXGPI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole (CID 11694720) is 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole is Fc1ccc2sc(-c3ccc4c(c3)OCO4)nc2c1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole?
The InChIKey is AANCATSPMWXGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8FNO2S/c15-9-2-4-13-10(6-9)16-14(19-13)8-1-3-11-12(5-8)18-7-17-11/h1-6H,7H2.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole?
2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole has a molecular weight of 273.29 g/mol, XLogP of 3.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-5-fluoro-1,3-benzothiazole is sourced from PubChem (CID 11694720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).