C14H30O3Si — CID 11694745
(2R,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhept-6-en-3-ol (PubChem CID 11694745) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is (2R,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhept-6-en-3-ol.
| Compound Name | (2R,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhept-6-en-3-ol |
|---|---|
| PubChem CID | 11694745 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2R,3S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyhept-6-en-3-ol |
| SMILES | C=CC[C@@H](OC)[C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3Si/c1-9-10-12(16-6)13(15)11(2)17-18(7,8)14(3,4)5/h9,11-13,15H,1,10H2,2-8H3/t11-,12-,13-/m1/s1 |
| InChIKey | OBBWZSPKJGOQGH-JHJVBQTASA-N |
| XLogP | 3.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|