C9H20N2O — CID 116948007
N,N'-dimethyl-1-(oxan-4-yl)ethane-1,2-diamine (PubChem CID 116948007) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N,N'-dimethyl-1-(oxan-4-yl)ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-1-(oxan-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116948007 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N,N'-dimethyl-1-(oxan-4-yl)ethane-1,2-diamine |
| SMILES | CNCC(NC)C1CCOCC1 |
| InChI | InChI=1S/C9H20N2O/c1-10-7-9(11-2)8-3-5-12-6-4-8/h8-11H,3-7H2,1-2H3 |
| InChIKey | PMTDRVKVHNFXAY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |