C10H15BrN2 — CID 116948009
1-(2-bromophenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 116948009) has the molecular formula C10H15BrN2 and a molecular weight of 243.15 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | 1-(2-bromophenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 116948009 |
| Molecular Formula | C10H15BrN2 |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1-(2-bromophenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCC(NC)c1ccccc1Br |
| InChI | InChI=1S/C10H15BrN2/c1-12-7-10(13-2)8-5-3-4-6-9(8)11/h3-6,10,12-13H,7H2,1-2H3 |
| InChIKey | PIWSSULCSVLQQQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |