C11H17FN2 — CID 116948511
1-(4-fluorophenyl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 116948511) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | 1-(4-fluorophenyl)-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116948511 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCC(NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H17FN2/c1-13-8-7-11(14-2)9-3-5-10(12)6-4-9/h3-6,11,13-14H,7-8H2,1-2H3 |
| InChIKey | XDFZYKVTDWTGRZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |