C13H19N3O — CID 116949295
5-[4-amino-1-(methylamino)butyl]-1,3-dihydroindol-2-one (PubChem CID 116949295) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-[4-amino-1-(methylamino)butyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[4-amino-1-(methylamino)butyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116949295 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 5-[4-amino-1-(methylamino)butyl]-1,3-dihydroindol-2-one |
| SMILES | CNC(CCCN)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H19N3O/c1-15-11(3-2-6-14)9-4-5-12-10(7-9)8-13(17)16-12/h4-5,7,11,15H,2-3,6,8,14H2,1H3,(H,16,17) |
| InChIKey | RQVWOXXOFVKXMJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |