C14H20N2O — CID 116949513
1-(1-benzofuran-3-yl)-N,N'-dimethylbutane-1,4-diamine (PubChem CID 116949513) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(1-benzofuran-3-yl)-N,N'-dimethylbutane-1,4-diamine.
| Compound Name | 1-(1-benzofuran-3-yl)-N,N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949513 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(1-benzofuran-3-yl)-N,N'-dimethylbutane-1,4-diamine |
| SMILES | CNCCCC(NC)c1coc2ccccc12 |
| InChI | InChI=1S/C14H20N2O/c1-15-9-5-7-13(16-2)12-10-17-14-8-4-3-6-11(12)14/h3-4,6,8,10,13,15-16H,5,7,9H2,1-2H3 |
| InChIKey | NZSQNGUARXEORK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|