C16H18O3S — CID 11694961
methyl (1R,6S)-6-benzylsulfanylcarbonylcyclohex-3-ene-1-carboxylate (PubChem CID 11694961) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is methyl (1R,6S)-6-benzylsulfanylcarbonylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,6S)-6-benzylsulfanylcarbonylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11694961 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methyl (1R,6S)-6-benzylsulfanylcarbonylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=CC[C@@H]1C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C16H18O3S/c1-19-15(17)13-9-5-6-10-14(13)16(18)20-11-12-7-3-2-4-8-12/h2-8,13-14H,9-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | QECVMSKGXCMDSO-KGLIPLIRSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|