C14H22N2O2 — CID 116951034
1-(2,4-dimethoxyphenyl)-N-methyl-1-pyrrolidin-3-ylmethanamine (PubChem CID 116951034) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-methyl-1-pyrrolidin-3-ylmethanamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-methyl-1-pyrrolidin-3-ylmethanamine |
|---|---|
| PubChem CID | 116951034 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-methyl-1-pyrrolidin-3-ylmethanamine |
| SMILES | CNC(c1ccc(OC)cc1OC)C1CCNC1 |
| InChI | InChI=1S/C14H22N2O2/c1-15-14(10-6-7-16-9-10)12-5-4-11(17-2)8-13(12)18-3/h4-5,8,10,14-16H,6-7,9H2,1-3H3 |
| InChIKey | KQOBXSASJHOYTA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |