About 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide
4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide (PubChem CID 11695300) has the molecular formula C16H9FN2O4
and a molecular weight of 312.26 g/mol. Its IUPAC name is 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide |
| PubChem CID | 11695300 |
| Molecular Formula | C16H9FN2O4 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide |
| SMILES | O=C1NC(=O)c2cccc(NC(=O)c3ccc(F)cc3)c2C1=O |
| InChI | InChI=1S/C16H9FN2O4/c17-9-6-4-8(5-7-9)14(21)18-11-3-1-2-10-12(11)13(20)16(23)19-15(10)22/h1-7H,(H,18,21)(H,19,22,23) |
| InChIKey | LSDAZQSCMLSVKU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide?
The IUPAC name of 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide (CID 11695300) is 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide.
What is the SMILES notation for 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide?
The canonical SMILES for 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide is O=C1NC(=O)c2cccc(NC(=O)c3ccc(F)cc3)c2C1=O.
What is the InChIKey of 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide?
The InChIKey is LSDAZQSCMLSVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9FN2O4/c17-9-6-4-8(5-7-9)14(21)18-11-3-1-2-10-12(11)13(20)16(23)19-15(10)22/h1-7H,(H,18,21)(H,19,22,23).
What are the key properties of 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide?
4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide has a molecular weight of 312.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(1,3,4-trioxoisoquinolin-5-yl)benzamide is sourced from PubChem (CID 11695300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).