About benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate
benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate (PubChem CID 11695395) has the molecular formula C16H19N3O4
and a molecular weight of 317.34 g/mol. Its IUPAC name is benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate |
| PubChem CID | 11695395 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate |
| SMILES | O=C(NCCCCn1ccc(=O)[nH]c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N3O4/c20-14-8-11-19(15(21)18-14)10-5-4-9-17-16(22)23-12-13-6-2-1-3-7-13/h1-3,6-8,11H,4-5,9-10,12H2,(H,17,22)(H,18,20,21) |
| InChIKey | VRZNLHUABPGNRM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate?
The IUPAC name of benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate (CID 11695395) is benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate.
What is the SMILES notation for benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate?
The canonical SMILES for benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate is O=C(NCCCCn1ccc(=O)[nH]c1=O)OCc1ccccc1.
What is the InChIKey of benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate?
The InChIKey is VRZNLHUABPGNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c20-14-8-11-19(15(21)18-14)10-5-4-9-17-16(22)23-12-13-6-2-1-3-7-13/h1-3,6-8,11H,4-5,9-10,12H2,(H,17,22)(H,18,20,21).
What are the key properties of benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate?
benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate has a molecular weight of 317.34 g/mol, XLogP of 1.24, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[4-(2,4-dioxopyrimidin-1-yl)butyl]carbamate is sourced from PubChem (CID 11695395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).