C15H20FNO2 — CID 116953971
4-[(2-fluorophenyl)-(methylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 116953971) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)-(methylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-fluorophenyl)-(methylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 116953971 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-[(2-fluorophenyl)-(methylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CNC(c1ccccc1F)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H20FNO2/c1-17-14(12-4-2-3-5-13(12)16)10-6-8-11(9-7-10)15(18)19/h2-5,10-11,14,17H,6-9H2,1H3,(H,18,19) |
| InChIKey | JDZDTYAQMMHGNX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |