C13H20N2 — CID 116954289
N,N'-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)methanediamine (PubChem CID 116954289) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N,N'-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)methanediamine.
| Compound Name | N,N'-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)methanediamine |
|---|---|
| PubChem CID | 116954289 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N,N'-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)methanediamine |
| SMILES | CNC(NC)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H20N2/c1-14-13(15-2)12-8-7-10-5-3-4-6-11(10)9-12/h7-9,13-15H,3-6H2,1-2H3 |
| InChIKey | JLDOUGMQKLVYQP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|