C11H16N2O — CID 116954398
1-(2,3-dihydro-1-benzofuran-5-yl)-N,N'-dimethylmethanediamine (PubChem CID 116954398) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-N,N'-dimethylmethanediamine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116954398 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-N,N'-dimethylmethanediamine |
| SMILES | CNC(NC)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H16N2O/c1-12-11(13-2)9-3-4-10-8(7-9)5-6-14-10/h3-4,7,11-13H,5-6H2,1-2H3 |
| InChIKey | IZGCNFODDZZGGI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|