C20H23N3O — CID 11695462
4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-(7-oxa-2-azabicyclo[4.1.0]hepta-1,3,5-trien-5-ylmethyl)aniline (PubChem CID 11695462) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-(7-oxa-2-azabicyclo[4.1.0]hepta-1,3,5-trien-5-ylmethyl)aniline.
| Compound Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-(7-oxa-2-azabicyclo[4.1.0]hepta-1,3,5-trien-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 11695462 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-(7-oxa-2-azabicyclo[4.1.0]hepta-1,3,5-trien-5-ylmethyl)aniline |
| SMILES | c1cc(CNc2ccc(C3CCC4CCCCN43)cc2)c2c(n1)O2 |
| InChI | InChI=1S/C20H23N3O/c1-2-12-23-17(3-1)8-9-18(23)14-4-6-16(7-5-14)22-13-15-10-11-21-20-19(15)24-20/h4-7,10-11,17-18,22H,1-3,8-9,12-13H2 |
| InChIKey | URHCAWZDYBYYKD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|