C16H20N6S — CID 11695590
N-benzyl-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methylpropane-1,3-diamine (PubChem CID 11695590) has the molecular formula C16H20N6S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-benzyl-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methylpropane-1,3-diamine.
| Compound Name | N-benzyl-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 11695590 |
| Molecular Formula | C16H20N6S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-benzyl-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNCc1ccccc1)c1nc(-n2ccnc2)ns1 |
| InChI | InChI=1S/C16H20N6S/c1-21(10-5-8-17-12-14-6-3-2-4-7-14)16-19-15(20-23-16)22-11-9-18-13-22/h2-4,6-7,9,11,13,17H,5,8,10,12H2,1H3 |
| InChIKey | BPGNDAYVHOVZHS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|