About 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate
2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 11695654) has the molecular formula C13H11F3N2O3S
and a molecular weight of 332.30 g/mol. Its IUPAC name is 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate |
| PubChem CID | 11695654 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | Cc1nc(-c2ccccc2C(F)(F)F)sc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C13H11F3N2O3S/c1-8-11(6-7-21-18(19)20)22-12(17-8)9-4-2-3-5-10(9)13(14,15)16/h2-5H,6-7H2,1H3 |
| InChIKey | SPHKYXDRJLKTDU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate?
The IUPAC name of 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate (CID 11695654) is 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate.
What is the SMILES notation for 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate?
The canonical SMILES for 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate is Cc1nc(-c2ccccc2C(F)(F)F)sc1CCO[N+](=O)[O-].
What is the InChIKey of 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate?
The InChIKey is SPHKYXDRJLKTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O3S/c1-8-11(6-7-21-18(19)20)22-12(17-8)9-4-2-3-5-10(9)13(14,15)16/h2-5H,6-7H2,1H3.
What are the key properties of 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate?
2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate has a molecular weight of 332.30 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl nitrate is sourced from PubChem (CID 11695654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).