C12H16N4O2 — CID 116957399
2-amino-3-(methylamino)-3-(1-methylbenzimidazol-5-yl)propanoic acid (PubChem CID 116957399) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-amino-3-(methylamino)-3-(1-methylbenzimidazol-5-yl)propanoic acid.
| Compound Name | 2-amino-3-(methylamino)-3-(1-methylbenzimidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 116957399 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-amino-3-(methylamino)-3-(1-methylbenzimidazol-5-yl)propanoic acid |
| SMILES | CNC(c1ccc2c(c1)ncn2C)C(N)C(=O)O |
| InChI | InChI=1S/C12H16N4O2/c1-14-11(10(13)12(17)18)7-3-4-9-8(5-7)15-6-16(9)2/h3-6,10-11,14H,13H2,1-2H3,(H,17,18) |
| InChIKey | LHQRLWFYJBDJSJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |