C11H19NO3 — CID 116959386
3-[cyclopentyl(methylamino)methyl]oxetane-3-carboxylic acid (PubChem CID 116959386) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-[cyclopentyl(methylamino)methyl]oxetane-3-carboxylic acid.
| Compound Name | 3-[cyclopentyl(methylamino)methyl]oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 116959386 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 3-[cyclopentyl(methylamino)methyl]oxetane-3-carboxylic acid |
| SMILES | CNC(C1CCCC1)C1(C(=O)O)COC1 |
| InChI | InChI=1S/C11H19NO3/c1-12-9(8-4-2-3-5-8)11(10(13)14)6-15-7-11/h8-9,12H,2-7H2,1H3,(H,13,14) |
| InChIKey | ZQRFZMSWEMHWDZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |