C16H7F5N4 — CID 11695985
1-benzyl-5-(2,3,4,5,6-pentafluorophenyl)triazole-4-carbonitrile (PubChem CID 11695985) has the molecular formula C16H7F5N4 and a molecular weight of 350.25 g/mol. Its IUPAC name is 1-benzyl-5-(2,3,4,5,6-pentafluorophenyl)triazole-4-carbonitrile.
| Compound Name | 1-benzyl-5-(2,3,4,5,6-pentafluorophenyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 11695985 |
| Molecular Formula | C16H7F5N4 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-benzyl-5-(2,3,4,5,6-pentafluorophenyl)triazole-4-carbonitrile |
| SMILES | N#Cc1nnn(Cc2ccccc2)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H7F5N4/c17-11-10(12(18)14(20)15(21)13(11)19)16-9(6-22)23-24-25(16)7-8-4-2-1-3-5-8/h1-5H,7H2 |
| InChIKey | VQEJDJMKGJFDMO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|