C15H24BrN3 — CID 116960927
1-(3-bromophenyl)-N-methyl-3-piperazin-1-ylbutan-1-amine (PubChem CID 116960927) has the molecular formula C15H24BrN3 and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-methyl-3-piperazin-1-ylbutan-1-amine.
| Compound Name | 1-(3-bromophenyl)-N-methyl-3-piperazin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 116960927 |
| Molecular Formula | C15H24BrN3 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-(3-bromophenyl)-N-methyl-3-piperazin-1-ylbutan-1-amine |
| SMILES | CNC(CC(C)N1CCNCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H24BrN3/c1-12(19-8-6-18-7-9-19)10-15(17-2)13-4-3-5-14(16)11-13/h3-5,11-12,15,17-18H,6-10H2,1-2H3 |
| InChIKey | OGJJQGUNRJLRJB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |