About 1-hydrazinyl-N,3-dimethylbutan-1-amine
1-hydrazinyl-N,3-dimethylbutan-1-amine (PubChem CID 116961688) has the molecular formula C6H17N3
and a molecular weight of 131.22 g/mol. Its IUPAC name is 1-hydrazinyl-N,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-hydrazinyl-N,3-dimethylbutan-1-amine |
| PubChem CID | 116961688 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | 1-hydrazinyl-N,3-dimethylbutan-1-amine |
| SMILES | CNC(CC(C)C)NN |
| InChI | InChI=1S/C6H17N3/c1-5(2)4-6(8-3)9-7/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | DCQVULOYLSGYQW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinyl-N,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinyl-N,3-dimethylbutan-1-amine?
The IUPAC name of 1-hydrazinyl-N,3-dimethylbutan-1-amine (CID 116961688) is 1-hydrazinyl-N,3-dimethylbutan-1-amine.
What is the SMILES notation for 1-hydrazinyl-N,3-dimethylbutan-1-amine?
The canonical SMILES for 1-hydrazinyl-N,3-dimethylbutan-1-amine is CNC(CC(C)C)NN.
What is the InChIKey of 1-hydrazinyl-N,3-dimethylbutan-1-amine?
The InChIKey is DCQVULOYLSGYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N3/c1-5(2)4-6(8-3)9-7/h5-6,8-9H,4,7H2,1-3H3.
What are the key properties of 1-hydrazinyl-N,3-dimethylbutan-1-amine?
1-hydrazinyl-N,3-dimethylbutan-1-amine has a molecular weight of 131.22 g/mol, XLogP of 0.04, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinyl-N,3-dimethylbutan-1-amine is sourced from PubChem (CID 116961688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).