C11H19N3O — CID 116961759
1-hydrazinyl-1-(2-methoxy-3,5-dimethylphenyl)-N-methylmethanamine (PubChem CID 116961759) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-hydrazinyl-1-(2-methoxy-3,5-dimethylphenyl)-N-methylmethanamine.
| Compound Name | 1-hydrazinyl-1-(2-methoxy-3,5-dimethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116961759 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-hydrazinyl-1-(2-methoxy-3,5-dimethylphenyl)-N-methylmethanamine |
| SMILES | CNC(NN)c1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C11H19N3O/c1-7-5-8(2)10(15-4)9(6-7)11(13-3)14-12/h5-6,11,13-14H,12H2,1-4H3 |
| InChIKey | AVLBPEVEEIONMI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|