About 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline
4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline (PubChem CID 116962482) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline.
Molecular Properties
| Compound Name | 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline |
| PubChem CID | 116962482 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline |
| SMILES | CNc1ccc(-c2cc(C)cc(C)c2OC)cc1 |
| InChI | InChI=1S/C16H19NO/c1-11-9-12(2)16(18-4)15(10-11)13-5-7-14(17-3)8-6-13/h5-10,17H,1-4H3 |
| InChIKey | ANWCJEKQQWPQCE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline?
The IUPAC name of 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline (CID 116962482) is 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline.
What is the SMILES notation for 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline?
The canonical SMILES for 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline is CNc1ccc(-c2cc(C)cc(C)c2OC)cc1.
What is the InChIKey of 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline?
The InChIKey is ANWCJEKQQWPQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c1-11-9-12(2)16(18-4)15(10-11)13-5-7-14(17-3)8-6-13/h5-10,17H,1-4H3.
What are the key properties of 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline?
4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline has a molecular weight of 241.33 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxy-3,5-dimethylphenyl)-N-methylaniline is sourced from PubChem (CID 116962482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).