C12H13NOS — CID 116963130
2-(1-benzothiophen-3-yl)morpholine (PubChem CID 116963130) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)morpholine.
| Compound Name | 2-(1-benzothiophen-3-yl)morpholine |
|---|---|
| PubChem CID | 116963130 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)morpholine |
| SMILES | c1ccc2c(C3CNCCO3)csc2c1 |
| InChI | InChI=1S/C12H13NOS/c1-2-4-12-9(3-1)10(8-15-12)11-7-13-5-6-14-11/h1-4,8,11,13H,5-7H2 |
| InChIKey | BTBVZMAFEFEYMT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |